CAS 1155-62-0

N-Benzyloxycarbonyl-L-glutamic acid

Description:

N-Benzyloxycarbonyl-L-glutamic acid, commonly referred to as Z-L-glutamic acid, is a derivative of the amino acid glutamic acid, characterized by the presence of a benzyloxycarbonyl (Z) protecting group. This compound is typically utilized in peptide synthesis as a protecting group for the amino group of glutamic acid, facilitating the selective modification of other functional groups during chemical reactions. It is a white to off-white crystalline solid that is soluble in organic solvents such as methanol and dimethyl sulfoxide, but less soluble in water. The presence of the benzyloxycarbonyl group enhances the stability of the amino acid under various reaction conditions, making it a valuable intermediate in the synthesis of peptides and other bioactive compounds. Additionally, N-Benzyloxycarbonyl-L-glutamic acid can participate in various chemical reactions, including coupling reactions with other amino acids, contributing to its utility in organic synthesis and medicinal chemistry. Its molecular structure includes both carboxylic acid and amine functional groups, which are crucial for its reactivity and interactions in biochemical processes.

Formula:C₁₃H₁₅NO₆

InChI:InChI=1/C13H15NO6/c15-11(16)7-6-10(12(17)18)14-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,19)(H,15,16)(H,17,18)/t10-/m1/s1

InChI key:InChIKey=PVFCXMDXBIEMQG-JTQLQIEISA-N

SMILES:C(OC(N[C@@H](CCC(O)=O)C(O)=O)=O)C1=CC=CC=C1

Synonyms: