CAS 1155419-89-8
:(αS,4R)-4-(2,3-Dihydropyrano[4,3,2-de]quinolin-7-yl)-α-(1,1-dimethylethoxy)-2-methyl-3-quinolineacetic acid
Description:
The chemical substance known as (αS,4R)-4-(2,3-Dihydropyrano[4,3,2-de]quinolin-7-yl)-α-(1,1-dimethylethoxy)-2-methyl-3-quinolineacetic acid, with the CAS number 1155419-89-8, is a complex organic compound characterized by its unique structural features, including a quinoline backbone and a dihydropyrano moiety. This compound exhibits chirality, indicated by its specific stereochemical descriptors, which can influence its biological activity and interactions. The presence of functional groups such as carboxylic acid and ether contributes to its potential solubility and reactivity in various solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's intricate arrangement of rings and substituents may also impart specific pharmacokinetic properties, making it a candidate for further investigation in drug discovery and development. Overall, this substance represents a fascinating example of synthetic organic chemistry with potential implications in therapeutic applications.
Formula:C27H26N2O4
InChI:InChI=1S/C27H26N2O4/c1-15-21(25(26(30)31)33-27(2,3)4)23(17-7-5-6-8-19(17)29-15)18-9-10-20-22-16(12-14-32-20)11-13-28-24(18)22/h5-11,13,25H,12,14H2,1-4H3,(H,30,31)
InChI key:InChIKey=MIXIIJCBELCMCZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(C(O)=O)C1=C(C2=C(N=C1C)C=CC=C2)C=3C=4C=5C(=CC3)OCCC5C=CN4
Synonyms:- BI 224436
- 2-(tert-Butoxy)-2-(4-(2,3-dihydropyrano[4,3,2-de]quinolin-7-yl)-2-methylquinolin-3-yl)acetic acid
- 3-Quinolineacetic acid, 4-(2,3-dihydropyrano[4,3,2-de]quinolin-7-yl)-α-(1,1-dimethylethoxy)-2-methyl-, (αS,4R)-
- (αS,4R)-4-(2,3-Dihydropyrano[4,3,2-de]quinolin-7-yl)-α-(1,1-dimethylethoxy)-2-methyl-3-quinolineacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
BI 224436
CAS:BI 224436 is an integrase inhibitor that blocks the action of the HIV integrase enzyme, a type of enzyme that integrates viral DNA into human cells and is essential for replication. In vitro experiments have shown that BI 224436 has antiviral activity against HIV-1 and other virus types. BI 224436 has been shown to inhibit the growth of viruses in human serum and in caco-2 cells. It also inhibits the proliferation of T cell lymphocytes, which may be due to its ability to block the binding site for growth factor. BI 224436 does not show toxicity in bladder tissue, but it does produce adverse effects on kidney tissue.Formula:C27H26N2O4Purity:Min. 95%Molecular weight:442.51 g/molBI 224436
CAS:BI 224436 is an inhibitor of HIV-1 noncatalytic site integrase. With EC50 values of less than 15 nM against different HIV-1 laboratory strains.Formula:C27H26N2O4Color and Shape:SolidMolecular weight:442.51



