CymitQuimica logo

CAS 115546-66-2

:

Tazobactam Impurity B

Description:
Tazobactam Impurity B, with the CAS number 115546-66-2, is a chemical compound that is recognized as an impurity associated with the synthesis of tazobactam, a β-lactamase inhibitor used in combination with certain antibiotics to enhance their efficacy against resistant bacterial strains. This impurity is typically characterized by its molecular structure, which may include functional groups that contribute to its chemical reactivity and stability. In terms of physical properties, it may exhibit characteristics such as solubility in organic solvents and varying degrees of stability under different pH conditions. The presence of impurities like Tazobactam Impurity B in pharmaceutical formulations is closely monitored due to potential impacts on drug efficacy and safety. Analytical techniques such as high-performance liquid chromatography (HPLC) and mass spectrometry are commonly employed to identify and quantify such impurities in drug development and quality control processes. Understanding the characteristics of impurities is crucial for ensuring the overall quality and safety of pharmaceutical products.
Formula:C10H12N4O5S
InChI:InChI=1S/C10H12N4O5S/c1-10(5-13-3-2-11-12-13)8(9(16)17)14-6(15)4-7(14)20(10,18)19/h2-3,7-8H,4-5H2,1H3,(H,16,17)/t7-,8+,10-/m1/s1
InChI key:LPQZKKCYTLCDGQ-KHQFGBGNSA-N
SMILES:C[C@]1([C@@H](N2[C@H](S1(=O)=O)CC2=O)C(=O)O)CN3C=CN=N3
Synonyms:
  • 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3-methyl-7-oxo-3-(1H-1,2,3-triazol-1-ylmethyl)-, 4,4-dioxide, (2S,3R,5R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.