CymitQuimica logo

CAS 115571-68-1

:

2,3-Dichloro-4-methyl-1-nitro-5-(trifluoromethyl)benzene

Description:
2,3-Dichloro-4-methyl-1-nitro-5-(trifluoromethyl)benzene, with CAS number 115571-68-1, is an aromatic compound characterized by the presence of multiple functional groups, including chlorine, methyl, nitro, and trifluoromethyl substituents on a benzene ring. This compound typically exhibits a complex structure due to the presence of these substituents, which can influence its chemical reactivity and physical properties. The dichloro and trifluoromethyl groups contribute to its lipophilicity and potential for environmental persistence, while the nitro group can impart electrophilic characteristics, making it reactive under certain conditions. The compound is likely to be a solid at room temperature, with a relatively high melting point due to the strong intermolecular forces associated with its halogen and nitro groups. Its applications may include use in organic synthesis, agrochemicals, or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose environmental and health hazards.
Formula:C8H4Cl2F3NO2
InChI:InChI=1S/C8H4Cl2F3NO2/c1-3-4(8(11,12)13)2-5(14(15)16)7(10)6(3)9/h2H,1H3
InChI key:InChIKey=CDAGFTHJEWDKIZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C)C(Cl)=C(Cl)C(N(=O)=O)=C1
Synonyms:
  • 2,3-Dichloro-4-methyl-1-nitro-5-(trifluoromethyl)benzene
  • Benzene, 2,3-dichloro-4-methyl-1-nitro-5-(trifluoromethyl)
  • 2,3-Dichloro-6-trifluoromethyl-4-nitrotoluene
Found 2 products.