CymitQuimica logo

CAS 115595-27-2

:

Butenyloxybenzoicacid

Description:
Butenyloxybenzoic acid, identified by its CAS number 115595-27-2, is an organic compound characterized by the presence of both a butenyl group and a benzoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic structures, which can influence its reactivity and solubility. The butenyl group introduces unsaturation, potentially allowing for various chemical reactions such as addition or polymerization. The benzoic acid component contributes to its acidity and can participate in hydrogen bonding, affecting its interactions with other molecules. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and the presence of functional groups. As with any chemical substance, safety data and handling precautions should be consulted to ensure proper use and management in laboratory or industrial settings.
Formula:C11H12O3
InChI:InChI=1/C11H12O3/c1-2-3-8-14-10-6-4-9(5-7-10)11(12)13/h2,4-7H,1,3,8H2,(H,12,13)
InChI key:QXZIOUAINSTHGI-UHFFFAOYSA-N
SMILES:C=CCCOc1ccc(cc1)C(=O)O
Synonyms:
  • 4-(3-Butenyloxy)benzoic acid
  • 4-(But-3-En-1-Yloxy)Benzoic Acid
Found 5 products.