CymitQuimica logo

CAS 115627-36-6

:

L-Leucine, N-(1H-indol-3-ylcarbonyl)-

Description:
L-Leucine, N-(1H-indol-3-ylcarbonyl)- is a chemical compound that features a combination of the amino acid L-leucine and an indole-derived carbonyl group. This compound is characterized by its structural complexity, which includes a branched-chain amino acid (L-leucine) known for its role in protein synthesis and muscle metabolism. The indole moiety contributes to the compound's potential biological activity, as indole derivatives are often associated with various pharmacological properties. The presence of the carbonyl group suggests potential reactivity, making it a candidate for further chemical modifications or interactions. This compound may exhibit unique solubility and stability characteristics due to its dual nature, combining hydrophobic and polar functional groups. Its specific applications could range from biochemical research to potential therapeutic uses, although detailed studies would be necessary to elucidate its full biological profile and efficacy. As with many compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C15H18N2O3
InChI:InChI=1S/C15H18N2O3/c1-9(2)7-13(15(19)20)17-14(18)11-8-16-12-6-4-3-5-10(11)12/h3-6,8-9,13,16H,7H2,1-2H3,(H,17,18)(H,19,20)/t13-/m0/s1
InChI key:QOPDNNGVRUWRIS-ZDUSSCGKSA-N
SMILES:CC(C)C[C@@H](C(=O)O)NC(=O)C1=CNC2=CC=CC=C21
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.