CymitQuimica logo

CAS 1156352-60-1

:

benzyl N-(1H-pyrazol-4-yl)carbamate

Description:
Benzyl N-(1H-pyrazol-4-yl)carbamate is an organic compound characterized by its carbamate functional group, which is linked to a benzyl group and a pyrazole moiety. This compound typically exhibits properties associated with both the aromatic benzyl group and the heterocyclic pyrazole, contributing to its potential biological activity. It is likely to be a white to off-white solid, soluble in organic solvents, and may have moderate stability under standard conditions. The presence of the pyrazole ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of pyrazole derivatives. The compound may also exhibit specific reactivity patterns typical of carbamates, such as hydrolysis under acidic or basic conditions. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Overall, benzyl N-(1H-pyrazol-4-yl)carbamate is a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c15-11(14-10-6-12-13-7-10)16-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)
InChI key:HOYQHOBEVBNOHC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC(=O)NC2=CNN=C2
Synonyms:
  • Carbamic acid, N-1H-pyrazol-4-yl-, phenylmethyl ester
  • benzyl N-(1H-pyrazol-4-yl)carbamate
  • Benzyl (1H-pyrazol-4-yl)carbamate
Found 1 products.