CAS 1156542-33-4: 2-Cyclopropyl-4-(trifluoromethyl)pyridine

Description:2-Cyclopropyl-4-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a cyclopropyl group and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and biological activity. The cyclopropyl moiety introduces ring strain, which can lead to unique reactivity patterns compared to more stable alkyl groups. This compound is typically colorless to pale yellow and may exhibit moderate volatility. It is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyridine ring is a common scaffold in drug design. Additionally, the presence of fluorine atoms can enhance metabolic stability and influence pharmacokinetics. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.

Formula:C₉H₈F₃N

InChI:InChI=1S/C9H8F3N/c10-9(11,12)7-3-4-13-8(5-7)6-1-2-6/h3-6H,1-2H2

InChI key:InChIKey=PEUDEOKYEBTHIE-UHFFFAOYSA-N

SMILES:FC(F)(F)C=1C=CN=C(C1)C2CC2