CymitQuimica logo

CAS 115692-31-4

:

L-Tryptophan, 1,1-dimethylethyl ester, monohydrochloride

Description:
L-Tryptophan, 1,1-dimethylethyl ester, monohydrochloride is a chemical compound derived from the amino acid L-Tryptophan, which is essential for protein synthesis and serves as a precursor for neurotransmitters such as serotonin. This compound is characterized by its esterification with a tert-butyl group, enhancing its lipophilicity and potentially influencing its bioavailability and pharmacokinetics. As a monohydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various biochemical applications. The compound may exhibit properties such as being hygroscopic and having a specific melting point, which are important for its handling and storage. Additionally, L-Tryptophan derivatives are often studied for their roles in metabolic pathways and their potential therapeutic effects, including mood regulation and sleep enhancement. Safety data should be consulted for handling, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C15H20N2O2ClH
InChI:InChI=1S/C15H20N2O2.ClH/c1-15(2,3)19-14(18)12(16)8-10-9-17-13-7-5-4-6-11(10)13;/h4-7,9,12,17H,8,16H2,1-3H3;1H/t12-;/m0./s1
InChI key:MEBSYCWJZVVILK-YDALLXLXSA-N
SMILES:CC(C)(C)OC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl
Found 3 products.