CAS 115761-61-0: 1-(3-BIPHENYLYL)PIPERAZINE

Description:1-(3-Biphenylyl)piperazine, identified by its CAS number 115761-61-0, is a chemical compound characterized by its piperazine core substituted with a biphenyl group. This compound typically exhibits properties associated with piperazine derivatives, including potential psychoactive effects and interactions with various neurotransmitter receptors. It is often studied for its relevance in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. The biphenyl moiety contributes to its lipophilicity, influencing its solubility and bioavailability. Additionally, the compound may exhibit specific stereochemical configurations that can affect its biological activity. Its synthesis usually involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, 1-(3-biphenylyl)piperazine serves as a valuable compound in research, particularly in the fields of pharmacology and medicinal chemistry.

Formula:C₁₆H₁₈N₂

InChI:InChI=1/C16H18N2/c1-2-5-14(6-3-1)15-7-4-8-16(13-15)18-11-9-17-10-12-18/h1-8,13,17H,9-12H2

Synonyms:
1-(Biphenyl-3-yl)piperazine
1-(3-Biphenylyl)-Piperazine >98%

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Piperazine, 1-[1,1'-biphenyl]-3-yl- REF: IN-DA000GTSCAS: 115761-61-0	95%	To inquire	Mon 31 Mar 25
1-(Biphenyl-3-yl)piperazine REF: 54-OR0864CAS: 115761-61-0	98%	262.00 €~802.00 €	Mon 07 Apr 25
1-(3-Biphenylyl)piperazine REF: 10-F022120CAS: 115761-61-0	98.0%	- - -	Discontinued product
1-Biphenyl-3-yl-piperazine REF: 3D-FB155064CAS: 115761-61-0	Min. 95%	- - -	Discontinued product