CymitQuimica logo

CAS 1157938-97-0

:

1-(2,5-difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone

Description:
1-(2,5-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a triazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the triazole ring, which is known for its role in various pharmacological applications. The difluorophenyl group may enhance lipophilicity and influence the compound's interaction with biological targets. In terms of solubility, such compounds often display moderate solubility in organic solvents, while their solubility in water can vary based on the specific functional groups present. The presence of fluorine atoms can also impart unique electronic properties, potentially affecting reactivity and stability. Overall, this compound may be of interest in medicinal chemistry and material science, particularly in the development of new pharmaceuticals or agrochemicals. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise information.
Formula:C10H7F2N3O
InChI:InChI=1S/C10H7F2N3O/c11-7-1-2-9(12)8(3-7)10(16)4-15-6-13-5-14-15/h1-3,5-6H,4H2
InChI key:TYSGXZUZAJOVML-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1F)C(=O)CN2C=NC=N2)F
Synonyms:
  • Isavuconazol Intermediate-1
  • 1-(2,5-Difluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one
Found 5 products.