CymitQuimica logo

CAS 115858-98-5

:

2-(4-FLUORO-PHENYL)-1-PYRIDIN-4-YL-ETHANONE

Description:
2-(4-Fluoro-phenyl)-1-pyridin-4-yl-ethanone, with the CAS number 115858-98-5, is an organic compound characterized by its unique structural features, which include a pyridine ring and a fluorophenyl group. This compound typically exhibits a molecular structure that includes a ketone functional group, contributing to its reactivity and potential applications in various chemical reactions. The presence of the fluorine atom enhances its electronic properties, potentially influencing its interactions in biological systems and its solubility in different solvents. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic rings, making it a valuable compound for further research in synthetic organic chemistry and drug design. Overall, 2-(4-Fluoro-phenyl)-1-pyridin-4-yl-ethanone represents a versatile building block in the synthesis of more complex molecules.
Formula:C13H10FNO
InChI:InChI=1S/C13H10FNO/c14-12-3-1-10(2-4-12)9-13(16)11-5-7-15-8-6-11/h1-8H,9H2
InChI key:SWLMSOXBPVFLNF-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1CC(=O)C2=CC=NC=C2)F
Found 2 products.