CymitQuimica logo

CAS 115863-92-8

:

8,10-Octadecadienoic acid, (8E,10E)-

Description:
8,10-Octadecadienoic acid, also known as (8E,10E)-octadecadienoic acid, is a polyunsaturated fatty acid characterized by its long carbon chain and two double bonds located at the 8th and 10th carbon atoms from the carboxylic acid end. This compound belongs to the family of omega-6 fatty acids and is typically found in various plant oils and fats. Its molecular structure contributes to its fluidity and reactivity, making it an important component in biological membranes and a precursor for various bioactive lipids. The presence of double bonds in the cis configuration influences its physical properties, such as melting point and solubility. 8,10-Octadecadienoic acid is of interest in nutritional and pharmaceutical research due to its potential health benefits, including anti-inflammatory properties and roles in metabolic processes. Additionally, it may be involved in the synthesis of signaling molecules that regulate various physiological functions. As with many fatty acids, its stability can be affected by factors such as temperature and exposure to light, which can lead to oxidation.
Formula:C18H32O2
InChI:InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h8-11H,2-7,12-17H2,1H3,(H,19,20)/b9-8+,11-10+
InChI key:QJKCKUNKNNYJNS-BNFZFUHLSA-N
SMILES:CCCCCCC/C=C/C=C/CCCCCCC(=O)O
Found 2 products.