CymitQuimica logo

CAS 1158736-09-4

:

2-Morpholineethanamine, 4-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2)

Description:
2-Morpholineethanamine, 4-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include a morpholine ring and an oxazolo[4,5-b]pyridine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. It may exhibit properties such as being a potential pharmacological agent, given the presence of both amine and heterocyclic components, which are often associated with biological activity. The morpholine group can contribute to its ability to interact with biological targets, while the oxazolo[4,5-b]pyridine structure may influence its electronic properties and reactivity. As with many organic compounds, its stability, solubility, and reactivity can be affected by environmental conditions such as pH and temperature. Safety data sheets and handling guidelines should be consulted for specific information regarding toxicity and safe usage. Overall, this compound represents a complex structure with potential applications in medicinal chemistry and related fields.
Formula:C12H16N4O2·2ClH
InChI:InChI=1S/C12H16N4O2.2ClH/c13-4-3-9-8-16(6-7-17-9)12-15-11-10(18-12)2-1-5-14-11;;/h1-2,5,9H,3-4,6-8,13H2;2*1H
InChI key:InChIKey=LGXWEHXTELIHOA-UHFFFAOYSA-N
SMILES:C(CN)C1CN(C2=NC=3C(O2)=CC=CN3)CCO1.Cl
Synonyms:
  • 2-Morpholineethanamine, 4-oxazolo[4,5-b]pyridin-2-yl-, hydrochloride (1:2)
Found 1 products.