CymitQuimica logo

CAS 1158749-83-7

:

1-Methyl-1,6-diazaspiro[3.4]octane

Description:
1-Methyl-1,6-diazaspiro[3.4]octane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. This compound features a nitrogen atom in both of its rings, contributing to its diaza designation. The presence of the methyl group at the 1-position enhances its stability and influences its reactivity. Typically, compounds like this may exhibit interesting pharmacological properties due to their structural features, which can affect their interaction with biological targets. The spiro configuration often leads to unique conformational characteristics, potentially impacting the compound's solubility and overall chemical behavior. Additionally, the presence of nitrogen atoms can introduce basicity and potential for hydrogen bonding, which are important in various chemical and biological contexts. As with many nitrogen-containing heterocycles, 1-Methyl-1,6-diazaspiro[3.4]octane may find applications in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-9-5-3-7(9)2-4-8-6-7/h8H,2-6H2,1H3
InChI key:InChIKey=GFANVZVARJDUIM-UHFFFAOYSA-N
SMILES:CN1C2(CCNC2)CC1
Synonyms:
  • 1-Methyl-1,7-diazaspiro[3.4]octane
  • 1,6-Diazaspiro[3.4]octane, 1-methyl-
  • 1-Methyl-1,6-diazaspiro[3.4]octane
Found 1 products.