CymitQuimica logo

CAS 1158749-85-9

:

1,7-Diazaspiro[4.5]decane-7-carboxylic acid, 2-oxo-, 1,1-diMethylethyl ester

Description:
1,7-Diazaspiro[4.5]decane-7-carboxylic acid, 2-oxo-, 1,1-diMethyl ethyl ester, identified by CAS number 1158749-85-9, is a chemical compound characterized by its unique spirocyclic structure, which includes a diazabicyclic framework. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, contributing to its lipophilicity and potential applications in medicinal chemistry. The presence of the 2-oxo group indicates that it may exhibit reactivity typical of carbonyl compounds, potentially participating in various chemical reactions such as nucleophilic additions. The spiro structure can influence the compound's conformational flexibility and steric properties, which are critical in determining its biological activity and interaction with biological targets. Additionally, the compound's molecular characteristics may suggest potential uses in pharmaceuticals, particularly in the development of novel therapeutic agents. However, specific biological activity, toxicity, and stability data would require further investigation through experimental studies.
Formula:C13H22N2O3
InChI:InChI=1S/C13H22N2O3/c1-12(2,3)18-11(17)15-8-4-6-13(9-15)7-5-10(16)14-13/h4-9H2,1-3H3,(H,14,16)
InChI key:OKTKWLDFMRBBTE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC2(C1)CCC(=O)N2
Synonyms:
  • Tert-Butyl 2-Oxo-1,7- Diazaspiro[4.5]Decane-7- Carboxylate
  • tert-butyl 2-oxo-1,9-diazaspiro[4.5]decane-9-carboxylate
  • 1,7-Diazaspiro[4.5]decane-7-carboxylic acid, 2-oxo-, 1,1-diMethylethyl ester
Found 3 products.