CymitQuimica logo

CAS 1158750-06-1

:

Phenylmethyl 1,9-diazaspiro[5.5]undecane-9-carboxylate

Description:
Phenylmethyl 1,9-diazaspiro[5.5]undecane-9-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates two nitrogen atoms within a bicyclic framework. This compound features a phenylmethyl group, contributing to its aromatic properties, and a carboxylate functional group, which can influence its reactivity and solubility. The presence of the diazaspiro moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the structural complexity that may enhance biological activity. The compound's molecular interactions are likely influenced by both the spiro structure and the functional groups, making it a candidate for further research in drug design and synthesis. Additionally, its specific stereochemistry and electronic properties can affect its behavior in various chemical environments, including its stability and reactivity with other substances. Overall, Phenylmethyl 1,9-diazaspiro[5.5]undecane-9-carboxylate represents a fascinating area of study within organic and medicinal chemistry.
Formula:C17H24N2O2
InChI:InChI=1S/C17H24N2O2/c20-16(21-14-15-6-2-1-3-7-15)19-12-9-17(10-13-19)8-4-5-11-18-17/h1-3,6-7,18H,4-5,8-14H2
InChI key:InChIKey=XPZOSNMGIILVJJ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CCC3(CC2)CCCCN3
Synonyms:
  • Phenylmethyl 1,9-diazaspiro[5.5]undecane-9-carboxylate
  • 1,9-Diazaspiro[5.5]undecane-9-carboxylic acid, phenylmethyl ester
Found 3 products.