
CAS 1158754-94-9
:Isoquinoline-6-carboxamide
Description:
Isoquinoline-6-carboxamide is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxamide functional group at the 6-position of the isoquinoline ring, contributing to its chemical reactivity and potential biological activity. Isoquinoline derivatives are known for their diverse pharmacological properties, including antitumor, antimicrobial, and anti-inflammatory effects. The presence of the carboxamide group enhances its solubility in polar solvents and may influence its interaction with biological targets. Isoquinoline-6-carboxamide can be synthesized through various methods, often involving the modification of isoquinoline precursors. Its applications may extend to medicinal chemistry, where it serves as a scaffold for drug development. Additionally, the compound's stability, melting point, and solubility characteristics are essential for its practical use in research and industry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c11-10(13)8-1-2-9-6-12-4-3-7(9)5-8/h1-6H,(H2,11,13)
InChI key:MBJVWMQHKCGMLZ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CN=C2)C=C1C(=O)N
Synonyms:- Isoquinoline-6-carboxamide
- Isoquinoline-6-carboxylic acid amide
- 6-Isoquinolinecarboxamide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
