CymitQuimica logo

CAS 1158758-77-0

:

1-Boc-3-amino-3-methyl-azetidine

Description:
1-Boc-3-amino-3-methyl-azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The "Boc" (tert-butoxycarbonyl) group is a common protecting group for amines, indicating that the amino group is protected to prevent unwanted reactions during synthetic processes. The presence of the methyl group at the 3-position of the azetidine ring contributes to the compound's steric and electronic properties, influencing its reactivity and interactions in chemical reactions. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules, due to its ability to serve as a building block or intermediate. Its characteristics include moderate polarity, which can affect solubility in various solvents, and it may exhibit specific reactivity patterns typical of amines and cyclic compounds. Overall, 1-Boc-3-amino-3-methyl-azetidine is a versatile compound in synthetic organic chemistry.
Formula:C9 H16 N2 O2
InChI:InChI=1S/C9H18N2O2/c1-8(2,3)13-7(12)11-5-9(4,10)6-11/h5-6,10H2,1-4H3
InChI key:LDWZHGRHSCFIJE-UHFFFAOYSA-N
SMILES:CC1(CN(C1)C(=O)OC(C)(C)C)N
Synonyms:
  • 3-Amino-1-Boc-3-methyl-azetidine
  • Tert-Butyl 3-Amino-3-Methylazetidine-1-Carboxylate
Found 6 products.