CymitQuimica logo

CAS 1158760-45-2

:

3-methyloxolane-3-carboxylic acid

Description:
3-Methyloxolane-3-carboxylic acid, identified by its CAS number 1158760-45-2, is a cyclic carboxylic acid featuring a five-membered oxolane (tetrahydrofuran) ring with a methyl group and a carboxylic acid functional group attached to the same carbon atom. This compound exhibits characteristics typical of carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents like water. The presence of the oxolane ring contributes to its unique structural properties, potentially affecting its reactivity and stability. It may participate in various chemical reactions, including esterification and decarboxylation, depending on the conditions. Additionally, the methyl group can influence the steric and electronic properties of the molecule, potentially affecting its interactions with other substances. While specific physical properties such as boiling point, melting point, and density are not provided, compounds of this class generally exhibit moderate volatility and can be synthesized through various organic reactions.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c1-6(5(7)8)2-3-9-4-6/h2-4H2,1H3,(H,7,8)
InChI key:FLZNEKJUIYLHAR-UHFFFAOYSA-N
SMILES:CC1(CCOC1)C(=O)O
Synonyms:
  • 3-Methyl-Tetrahydrofuran-3-Carboxylic Acid
  • Tetrahydro-3-Methylfuran-3-Carboxylic Acid
  • 3-Methyl-Oxolane-3-Carboxylic Acid
Found 4 products.