CymitQuimica logo

CAS 1159265-99-2

:

beta-D-Mannopyranosyl azide 3,4,6-triacetate 2-(1,1,1-trifluoromethanesulfonate)

Description:
Beta-D-Mannopyranosyl azide 3,4,6-triacetate 2-(1,1,1-trifluoromethanesulfonate) is a specialized chemical compound that features a beta-D-mannopyranosyl moiety, which is a six-membered cyclic sugar structure. The presence of azide and trifluoromethanesulfonate (triflate) functional groups indicates its potential utility in click chemistry and as a leaving group in nucleophilic substitution reactions. The triacetate groups suggest that the hydroxyl groups on the sugar are acetylated, enhancing the compound's stability and solubility in organic solvents. This compound is likely to be used in synthetic organic chemistry, particularly in glycosylation reactions or as an intermediate in the synthesis of more complex carbohydrate derivatives. Its unique functional groups may also impart specific reactivity, making it valuable in the development of glycosylated pharmaceuticals or bioconjugates. As with many azides, it should be handled with care due to potential explosive properties under certain conditions. Overall, this compound exemplifies the intersection of carbohydrate chemistry and synthetic methodology.
Formula:C13H16F3N3O10S
InChI:InChI=1S/C13H16F3N3O10S/c1-5(20)25-4-8-9(26-6(2)21)10(27-7(3)22)11(12(28-8)18-19-17)29-30(23,24)13(14,15)16/h8-12H,4H2,1-3H3/t8-,9-,10+,11+,12-/m1/s1
InChI key:KFNNMYXBFZYEBS-LDMBFOFVSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)N=[N+]=[N-])OS(=O)(=O)C(F)(F)F)OC(=O)C)OC(=O)C
Synonyms:
  • 3,4,6-Tri-O-acetyl-2-O-trifluoromethanesulfonyl-β-D-mannopyranosyl azide
  • beta-D-Mannopyranosyl azide 3,4,6-triacetate 2-(1,1,1-trifluoromethanesulfonate)
Found 3 products.