CymitQuimica logo

CAS 1159281-27-2

:

5′-Bromo-3-methyl-2,2′-bipyridine

Description:
5′-Bromo-3-methyl-2,2′-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of a bromine atom at the 5′ position and a methyl group at the 3 position contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, making it useful in various chemical applications. It is often employed in coordination chemistry, particularly as a ligand in metal complexes due to its ability to donate electron pairs from the nitrogen atoms in the pyridine rings. Additionally, the bromine substituent can participate in further chemical reactions, such as nucleophilic substitutions or coupling reactions, enhancing its utility in synthetic organic chemistry. The compound's structure allows for potential applications in materials science, catalysis, and medicinal chemistry, where its reactivity and coordination properties can be exploited for the development of new compounds or materials.
Formula:C11H9BrN2
InChI:InChI=1S/C11H9BrN2/c1-8-3-2-6-13-11(8)10-5-4-9(12)7-14-10/h2-7H,1H3
InChI key:InChIKey=HQBYDNBCRHSMFS-UHFFFAOYSA-N
SMILES:CC1=C(C2=CC=C(Br)C=N2)N=CC=C1
Synonyms:
  • 2,2′-Bipyridine, 5′-bromo-3-methyl-
  • 5′-Bromo-3-methyl-2,2′-bipyridine
  • 2-(5-Bromopyridin-2-yl)-3-methylpyridine
Found 1 products.