CymitQuimica logo

CAS 1159511-77-9

:

4-Bromo-1,5-dimethyl-1H-indazole

Description:
4-Bromo-1,5-dimethyl-1H-indazole is a chemical compound characterized by its indazole core, which consists of a five-membered ring fused to a six-membered aromatic ring. The presence of a bromine atom at the 4-position and two methyl groups at the 1 and 5 positions contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for various biological activities. The bromine substituent can also enhance reactivity, making it a useful intermediate in synthetic chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its interactions in biological systems. Overall, 4-Bromo-1,5-dimethyl-1H-indazole is of interest for its potential applications in drug discovery and development.
Formula:C9H9BrN2
InChI:InChI=1S/C9H9BrN2/c1-6-3-4-8-7(9(6)10)5-11-12(8)2/h3-5H,1-2H3
InChI key:InChIKey=IHCMWPGWHNBZAO-UHFFFAOYSA-N
SMILES:BrC1=C2C(N(C)N=C2)=CC=C1C
Synonyms:
  • 4-Bromo-1,5-dimethyl-1H-indazole
  • 1H-Indazole, 4-bromo-1,5-dimethyl-
Found 4 products.