CymitQuimica logo

CAS 115966-68-2

:

Histatin 5

Description:
Histatin 5 is a peptide that is part of the histatin family, which are histidine-rich proteins primarily found in human saliva. It is known for its antimicrobial properties, particularly against various bacteria and fungi, making it significant in oral health and potential therapeutic applications. The peptide exhibits a unique structure characterized by a high content of histidine residues, which contribute to its ability to bind metal ions and exhibit antimicrobial activity. Histatin 5 has also been shown to promote wound healing and has potential roles in tissue regeneration. Its mechanism of action involves disrupting microbial membranes and inhibiting the growth of pathogens. Additionally, histatin 5 is of interest in research related to its potential use in drug development and as a natural antimicrobial agent. Overall, its biological functions and properties make it a subject of interest in both microbiology and biochemistry.
Formula:C133H195N51O33
InChI:InChI=1/C133H195N51O33/c1-71(164-120(206)96(46-76-54-146-65-158-76)181-128(214)103(62-185)183-110(196)84(138)52-108(193)194)109(195)167-86(18-5-9-35-134)113(199)172-91(24-15-41-154-133(143)144)118(204)178-99(49-79-57-149-68-161-79)125(211)176-95(45-75-53-145-64-157-75)112(198)156-60-105(189)165-93(43-73-25-29-82(187)30-26-73)121(207)173-87(19-6-10-36-135)114(200)171-90(23-14-40-153-132(141)142)115(201)169-88(20-7-11-37-136)116(202)175-94(42-72-16-3-2-4-17-72)122(208)179-97(47-77-55-147-66-159-77)124(210)174-92(33-34-107(191)192)119(205)170-89(21-8-12-38-137)117(203)177-100(50-80-58-150-69-162-80)126(212)180-101(51-81-59-151-70-163-81)127(213)184-104(63-186)129(215)182-98(48-78-56-148-67-160-78)123(209)168-85(22-13-39-152-131(139)140)111(197)155-61-106(190)166-102(130(216)217)44-74-27-31-83(188)32-28-74/h2-4,16-17,25-32,53-59,64-71,84-104,185-188H,5-15,18-24,33-52,60-63,134-138H2,1H3,(H,145,157)(H,146,158)(H,147,159)(H,148,160)(H,149,161)(H,150,162)(H,151,163)(H,155,197)(H,156,198)(H,164,206)(H,165,189)(H,166,190)(H,167,195)(H,168,209)(H,169,201)(H,170,205)(H,171,200)(H,172,199)(H,173,207)(H,174,210)(H,175,202)(H,176,211)(H,177,203)(H,178,204)(H,179,208)(H,180,212)(H,181,214)(H,182,215)(H,183,196)(H,184,213)(H,191,192)(H,193,194)(H,216,217)(H4,139,140,152)(H4,141,142,153)(H4,143,144,154)/t71-,84-,85-,86-,87-,88-,89-,90-,91-,92-,93-,94-,95-,96-,97-,98-,99-,100-,101-,102-,103-,104-/m0/s1
InChI key:KSXBMTJGDUPBBN-VPKNIDFUSA-N
SMILES:C[C@@H](C(=N[C@@H](CCCCN)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](Cc1cnc[nH]1)C(=NCC(=N[C@@H](Cc1ccc(cc1)O)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCNC(=N)N)C(=N[C@@H](CCCCN)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](CCC(=O)O)C(=N[C@@H](CCCCN)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](CO)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](CCCNC(=N)N)C(=NCC(=N[C@@H](Cc1ccc(cc1)O)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C([C@H](Cc1cnc[nH]1)N=C([C@H](CO)N=C([C@H](CC(=O)O)N)O)O)O
Synonyms:
  • Histatin-5
Found 3 products.