CymitQuimica logo

CAS 1159821-42-7

:

5-cyclopropylpyridin-2-ol

Description:
5-Cyclopropylpyridin-2-ol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a hydroxyl group (-OH) at the 2-position of the pyridine contributes to its classification as a pyridin-2-ol. The cyclopropyl group, a three-membered carbon ring, is attached to the 5-position of the pyridine, influencing the compound's reactivity and physical properties. This structure can impart unique characteristics, such as increased strain and potential for ring-opening reactions. The compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. Additionally, 5-cyclopropylpyridin-2-ol can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can affect its interactions in biological systems or synthetic applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c10-8-4-3-7(5-9-8)6-1-2-6/h3-6H,1-2H2,(H,9,10)
InChI key:FWUCDCOUFJDYLH-UHFFFAOYSA-N
SMILES:C1CC1C2=CNC(=O)C=C2
Found 4 products.