CymitQuimica logo

CAS 1159822-24-8

:

Benzenepropanoic acid, 4-bromo-α-[(methylamino)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:
Benzenepropanoic acid, 4-bromo-α-[(methylamino)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a synthetic organic compound characterized by its complex structure, which includes a benzene ring, a propanoic acid moiety, and a bromo substituent. The presence of the methylamino group indicates potential biological activity, as amines often play a role in pharmacological properties. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its stability and bioavailability. The ester functional group suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding acid and alcohol. This compound may exhibit properties such as moderate to high lipophilicity due to the aromatic and aliphatic components, which can affect its interaction with biological membranes. Additionally, the presence of the bromo substituent may impart unique reactivity and influence the compound's overall chemical behavior. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C15H22BrNO2·ClH
InChI:InChI=1S/C15H22BrNO2.ClH/c1-15(2,3)19-14(18)12(10-17-4)9-11-5-7-13(16)8-6-11;/h5-8,12,17H,9-10H2,1-4H3;1H
InChI key:InChIKey=RKEXFBFEPNVAMK-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Br)C=C1)(C(OC(C)(C)C)=O)CNC.Cl
Synonyms:
  • Benzenepropanoic acid, 4-bromo-α-[(methylamino)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1)
Found 2 products.