CymitQuimica logo

CAS 1159825-10-1

:

1H-Pyrrole-2-carboxylic acid, 1-amino-, ethyl ester, hydrochloride (1:1)

Description:
1H-Pyrrole-2-carboxylic acid, 1-amino-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylic acid group and an amino group, contributing to its potential as a building block in organic synthesis and pharmaceuticals. The ethyl ester moiety enhances its solubility and reactivity, making it useful in various chemical reactions. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. The presence of both acidic and basic functional groups allows for diverse interactions, including hydrogen bonding and coordination with metal ions. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 1159825-10-1, uniquely identifies it in chemical databases, facilitating research and application in various fields, including drug development and agrochemicals.
Formula:C7H10N2O2·ClH
InChI:InChI=1S/C7H10N2O2.ClH/c1-2-11-7(10)6-4-3-5-9(6)8;/h3-5H,2,8H2,1H3;1H
InChI key:InChIKey=IJKYIIMMYDNXDG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N(N)C=CC1.Cl
Synonyms:
  • 1H-Pyrrole-2-carboxylic acid, 1-amino-, ethyl ester, hydrochloride (1:1)
Found 2 products.