CymitQuimica logo

CAS 115994-87-1

:

1-Piperazinecarboxamide, N-phenyl-

Description:
1-Piperazinecarboxamide, N-phenyl- is an organic compound characterized by its piperazine ring structure, which is a six-membered saturated heterocycle containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a polar molecule, and a phenyl group that enhances its aromatic properties. The presence of the piperazine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may exhibit various biological activities, including potential antimicrobial or antitumor properties, although specific biological data would depend on empirical studies. Its solubility characteristics are influenced by the functional groups present, which can affect its distribution in biological systems. As with many piperazine derivatives, it may also serve as a scaffold for further chemical modifications to enhance its efficacy or selectivity in therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c15-11(14-8-6-12-7-9-14)13-10-4-2-1-3-5-10/h1-5,12H,6-9H2,(H,13,15)
InChI key:YEQDVKYOHVLZPU-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C(=O)NC2=CC=CC=C2
Found 3 products.