CymitQuimica logo

CAS 1159977-18-0

:

2-Carboxyanthracene MTSEA Amide

Description:
2-Carboxyanthracene MTSEA Amide, identified by its CAS number 1159977-18-0, is a chemical compound that features an anthracene backbone substituted with a carboxylic acid group and an amide functional group. This compound is characterized by its polycyclic aromatic structure, which contributes to its potential applications in organic electronics and photonics due to its ability to absorb and emit light. The presence of the carboxylic acid group enhances its solubility in polar solvents, while the amide group can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the compound may exhibit fluorescence properties, making it useful in various analytical and imaging techniques. Its unique structure allows for potential applications in drug delivery systems and as a probe in biochemical assays. Overall, 2-Carboxyanthracene MTSEA Amide represents a versatile compound with significant implications in both materials science and biochemistry.
Formula:C18H17NO3S2
InChI:InChI=1S/C18H17NO3S2/c1-24(21,22)23-9-8-19-18(20)16-7-6-15-10-13-4-2-3-5-14(13)11-17(15)12-16/h2-7,10-12H,8-9H2,1H3,(H,19,20)
InChI key:JDQIUGACVGSHLI-UHFFFAOYSA-N
SMILES:CS(=O)(=O)SCCNC(=O)C1=CC2=CC3=CC=CC=C3C=C2C=C1
Synonyms:
  • 2-Carboxyanthracene MTSEA Amide
  • Methanesulfonothioic Acid S-[2-[(2-Anthracenylcarbonyl)aMino]ethyl] Ester
Found 1 products.