CymitQuimica logo

CAS 1159988-74-5

:

4-Bromo-3,5-bis(4-methylphenyl)-1H-pyrazole

Description:
4-Bromo-3,5-bis(4-methylphenyl)-1H-pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of bromine at the 4-position and two para-substituted 4-methylphenyl groups at the 3 and 5 positions contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the bulky aromatic groups, which can influence its solubility in organic solvents. The bromine substituent may also impart specific reactivity, making it a potential candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the compound may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological profile. Its molecular structure suggests potential uses in the development of agrochemicals or pharmaceuticals, particularly in areas where pyrazole derivatives are known to play a role. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H15BrN2
InChI:InChI=1S/C17H15BrN2/c1-11-3-7-13(8-4-11)16-15(18)17(20-19-16)14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,19,20)
InChI key:InChIKey=RUCKQMMHCIOMNR-UHFFFAOYSA-N
SMILES:BrC=1C(=NNC1C2=CC=C(C)C=C2)C3=CC=C(C)C=C3
Synonyms:
  • 4-Bromo-3,5-bis(4-methylphenyl)-1H-pyrazole
  • 1H-Pyrazole, 4-bromo-3,5-bis(4-methylphenyl)-
Found 1 products.