CAS 116-64-3: 4-Hydroxy-2-naphthalenesulfonamide

Description:4-Hydroxy-2-naphthalenesulfonamide, also known as sulfanilamide, is an organic compound characterized by its sulfonamide functional group attached to a naphthalene ring. It appears as a white to off-white crystalline solid and is soluble in water, particularly at elevated temperatures. This compound exhibits both acidic and basic properties due to the presence of the sulfonamide group and the hydroxyl group, allowing it to participate in various chemical reactions. It is known for its antibacterial properties and has been historically significant in the development of sulfa drugs, which were among the first antibiotics used in medicine. The compound can undergo sulfonation, nitration, and other electrophilic aromatic substitution reactions, making it versatile in synthetic organic chemistry. Additionally, it has applications in dye manufacturing and as a reagent in biochemical assays. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes.

Formula:C₁₀H₉NO₃S

InChI:InChI=1S/C10H9NO3S/c11-15(13,14)8-5-7-3-1-2-4-9(7)10(12)6-8/h1-6,12H,(H2,11,13,14)

InChI key:InChIKey=UVUPYJHRUARFIM-UHFFFAOYSA-N

SMILES:O=S(=O)(N)C=1C=C(O)C=2C=CC=CC2C1