CymitQuimica logo

CAS 116008-52-7

:

1H-Pyrazole-3-carboxylicacid,4-amino-

Description:
1H-Pyrazole-3-carboxylic acid, 4-amino- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 3-position and an amino group (-NH2) at the 4-position of the pyrazole ring. It is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of both the carboxylic acid and amino groups. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. Its molecular structure allows for various chemical modifications, which can enhance its pharmacological properties. As with many pyrazole derivatives, it may exhibit anti-inflammatory, analgesic, or antimicrobial activities, making it a subject of research in pharmaceutical sciences. Proper handling and safety measures should be observed, as with all chemical substances.
Formula:C4H5N3O2
InChI:InChI=1/C4H5N3O2/c5-2-1-6-7-3(2)4(8)9/h1H,5H2,(H,6,7)(H,8,9)
InChI key:SHRRRNSPESGSCM-UHFFFAOYSA-N
SMILES:c1c(c(C(=O)O)n[nH]1)N
Synonyms:
  • 1H-Pyrazole-3-carboxylicacid,4-amino-(9CI)
  • 4-amino-1H-pyrazole-5-carboxylic acid
Found 4 products.