CymitQuimica logo

CAS 1160246-71-8

:

tert-butyl 1-oxo-2,6-diazaspiro[3.5]nonane-6-carboxylate

Description:
Tert-butyl 1-oxo-2,6-diazaspiro[3.5]nonane-6-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of the diazaspiro framework suggests interesting steric and electronic properties, which may influence its reactivity and interactions in various chemical environments. The oxo group indicates the presence of a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Due to its structural complexity, this compound may exhibit specific biological activities or serve as a precursor in synthetic pathways for pharmaceuticals or agrochemicals. Its CAS number, 1160246-71-8, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in research and industry. Overall, the characteristics of this compound make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H20N2O3
InChI:InChI=1S/C12H20N2O3/c1-11(2,3)17-10(16)14-6-4-5-12(8-14)7-13-9(12)15/h4-8H2,1-3H3,(H,13,15)
InChI key:LNWMIRKPCFFSTI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC2(C1)CNC2=O
Synonyms:
  • 1-Oxo-2,6-Diazaspiro[3.5]Nonane-6-Carboxylic Acid Tert-Butyl Ester
Found 2 products.