CymitQuimica logo

CAS 1160246-91-2

:

1,1-Dimethylethyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate

Description:
1,1-Dimethylethyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate, identified by its CAS number 1160246-91-2, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a dimethyl group that contributes to its steric bulk, influencing its reactivity and interaction with biological systems. The presence of an amino group suggests potential for hydrogen bonding and reactivity in various chemical environments, while the carboxylate moiety indicates acidity and the ability to participate in ionic interactions. The oxa and aza components of the spiro structure enhance its complexity and may contribute to specific pharmacological properties. Such compounds are often of interest in medicinal chemistry due to their potential biological activity, including effects on neurotransmitter systems or as enzyme inhibitors. Overall, the structural characteristics of this compound suggest it may have applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H24N2O3
InChI:InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-6-4-13(5-7-15)8-10(14)9-17-13/h10H,4-9,14H2,1-3H3
InChI key:InChIKey=GBLUNQGZHFQTPW-UHFFFAOYSA-N
SMILES:NC1CC2(CCN(C(OC(C)(C)C)=O)CC2)OC1
Synonyms:
  • 1,1-Dimethylethyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate
  • 1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 3-amino-, 1,1-dimethylethyl ester
Found 3 products.