CymitQuimica logo

CAS 1160246-95-6

:

8-(1,1-Dimethylethyl) 2-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate

Description:
8-(1,1-Dimethylethyl) 2-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate is a chemical compound characterized by its complex spirocyclic structure, which includes both an oxo and an azaspiro moiety. The presence of the tert-butyl group (1,1-dimethylethyl) and the methyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with biological systems. The compound features two carboxylate functional groups, which can participate in various chemical reactions, including esterification and salt formation. Its unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity will depend on the solvent and environmental conditions, such as pH and temperature. Additionally, the presence of multiple functional groups suggests potential for diverse applications in organic synthesis and drug development. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C15H25NO5
InChI:InChI=1S/C15H25NO5/c1-14(2,3)21-13(18)16-9-7-15(8-10-16)6-5-11(20-15)12(17)19-4/h11H,5-10H2,1-4H3
InChI key:InChIKey=AAKXXTYECWMWHH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1OC2(CC1)CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 1-Oxa-8-azaspiro[4.5]decane-2,8-dicarboxylic acid, 8-(1,1-dimethylethyl) 2-methyl ester
  • 8-(1,1-Dimethylethyl) 2-methyl 1-oxa-8-azaspiro[4.5]decane-2,8-dicarboxylate
Found 3 products.