CAS 1160253-29-1
:6-Bromo-2-phenyl-4-quinolinecarbonyl chloride
Description:
6-Bromo-2-phenyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system, a bromine substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The bromine atom introduces additional reactivity and can influence the compound's physical properties, such as solubility and boiling point. The phenyl group contributes to the compound's aromatic character, potentially affecting its electronic properties and interactions with other molecules. In terms of applications, compounds like this may be utilized in organic synthesis, medicinal chemistry, or as intermediates in the production of more complex molecules. Safety considerations are important, as carbonyl chlorides can be hazardous, necessitating appropriate handling and storage measures. Overall, 6-Bromo-2-phenyl-4-quinolinecarbonyl chloride is a versatile compound with significant implications in various chemical contexts.
Formula:C16H9BrClNO
InChI:InChI=1S/C16H9BrClNO/c17-11-6-7-14-12(8-11)13(16(18)20)9-15(19-14)10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=MWBCYNXSUCEYQY-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CC=C3)C=CC(Br)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-bromo-2-phenyl-
- 6-Bromo-2-phenyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
