CAS 1160253-29-1: 6-Bromo-2-phenyl-4-quinolinecarbonyl chloride
Description:6-Bromo-2-phenyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system, a bromine substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The bromine atom introduces additional reactivity and can influence the compound's physical properties, such as solubility and boiling point. The phenyl group contributes to the compound's aromatic character, potentially affecting its electronic properties and interactions with other molecules. In terms of applications, compounds like this may be utilized in organic synthesis, medicinal chemistry, or as intermediates in the production of more complex molecules. Safety considerations are important, as carbonyl chlorides can be hazardous, necessitating appropriate handling and storage measures. Overall, 6-Bromo-2-phenyl-4-quinolinecarbonyl chloride is a versatile compound with significant implications in various chemical contexts.
Formula:C16H9BrClNO
InChI:InChI=1S/C16H9BrClNO/c17-11-6-7-14-12(8-11)13(16(18)20)9-15(19-14)10-4-2-1-3-5-10/h1-9H
InChI key:InChIKey=MWBCYNXSUCEYQY-UHFFFAOYSA-N
SMILES:O=C(Cl)C1=CC(=NC=2C=CC(Br)=CC21)C=3C=CC=CC3
- Synonyms:
- 4-Quinolinecarbonyl chloride, 6-bromo-2-phenyl-
- 6-Bromo-2-phenyl-4-quinolinecarbonyl chloride
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Quinolinecarbonyl chloride, 6-bromo-2-phenyl- REF: IN-DA000BEWCAS: 1160253-29-1 | - - - | To inquire | Mon 31 Mar 25 |
![]() | 6-bromo-2-phenylquinoline-4-carbonyl chloride REF: 10-F368375CAS: 1160253-29-1 | - - - | - - - | Discontinued product |
![]() | 6-Bromo-2-phenylquinoline-4-carbonyl chloride REF: 3D-FB120698CAS: 1160253-29-1 | Min. 95% | - - - | Discontinued product |

4-Quinolinecarbonyl chloride, 6-bromo-2-phenyl-
Ref: IN-DA000BEW
Undefined size | To inquire |

Ref: 10-F368375
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

6-Bromo-2-phenylquinoline-4-carbonyl chloride
Ref: 3D-FB120698
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |