
CAS 1160303-44-5
:Emtricitabine Impurity 16
Description:
Emtricitabine Impurity 16, identified by its CAS number 1160303-44-5, is a chemical compound that is recognized as an impurity associated with the antiretroviral drug emtricitabine, which is used in the treatment of HIV. This impurity is typically characterized by its molecular structure, which may include specific functional groups that can affect its chemical behavior and stability. The compound is likely to exhibit properties such as solubility in polar solvents, given its structural characteristics, and may have a defined melting point and boiling point that are typical for organic compounds. Its presence in pharmaceutical formulations is monitored due to potential impacts on drug efficacy and safety. Analytical techniques such as HPLC (High-Performance Liquid Chromatography) and mass spectrometry are commonly employed to detect and quantify impurities like Emtricitabine Impurity 16 in drug products. Understanding the characteristics of such impurities is crucial for ensuring the quality and compliance of pharmaceutical products.
Formula:C8H10FN3O4S
InChI:InChI=1S/C8H10FN3O4S/c9-4-1-12(8(14)11-7(4)10)5-3-17(15)6(2-13)16-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+,17-/m0/s1
InChI key:DMOMZPWPIDCLMB-CRRVBNTOSA-N
SMILES:C1[C@H](O[C@H]([S@]1=O)CO)N2C=C(C(=NC2=O)N)F
Synonyms:- Emtricitabine Impurity 16
- 4-amino-5-fluoro-1-((2R,3S,5S)-2-(hydroxymethyl)-3-oxido-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one
- 2(1H)-Pyrimidinone, 4-amino-5-fluoro-1-[(2R,3S,5S)-2-(hydroxymethyl)-3-oxido-1,3-oxathiolan-5-yl]-
- Emtricitabine (S)-sulphoxide
- Emtricitabine Impurity 39
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
