CymitQuimica logo

CAS 116047-26-8

:

2-Naphthalenecarboxylic acid, 5,6,7,8-tetrahydro-8-oxo-, methyl ester

Description:
2-Naphthalenecarboxylic acid, 5,6,7,8-tetrahydro-8-oxo-, methyl ester, with CAS number 116047-26-8, is an organic compound characterized by its naphthalene backbone and a carboxylic acid functional group that has been esterified with methanol. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and an oxo group, which contributes to its reactivity and potential applications in organic synthesis. The methyl ester form suggests that it is likely to exhibit moderate polarity, making it soluble in organic solvents while having limited solubility in water. Its structural characteristics may impart biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the naphthalene moiety can influence its electronic properties, potentially allowing for interactions with various biological targets. Overall, this compound's unique structure positions it as a candidate for further investigation in both synthetic and medicinal chemistry contexts.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-15-12(14)9-6-5-8-3-2-4-11(13)10(8)7-9/h5-7H,2-4H2,1H3
InChI key:CIZUNRVGSYFMQM-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC2=C(CCCC2=O)C=C1
Found 5 products.