CymitQuimica logo

CAS 1160474-76-9

:

Methyl 4-(2,3-dichloro-4-pyridinyl)benzoate

Description:
Methyl 4-(2,3-dichloro-4-pyridinyl)benzoate is a chemical compound characterized by its specific molecular structure, which includes a benzoate moiety and a pyridine ring substituted with dichloro groups. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dichloro substituents on the pyridine ring can influence its reactivity and biological activity, making it of interest for research and development. The compound's molecular formula and weight contribute to its physical properties, such as solubility and melting point, which are essential for understanding its behavior in different environments. Additionally, safety data sheets would provide information on handling, storage, and potential hazards associated with this substance. Overall, Methyl 4-(2,3-dichloro-4-pyridinyl)benzoate is a compound that exemplifies the complexity and utility of halogenated organic molecules in chemical synthesis and application.
Formula:C13H9Cl2NO2
InChI:InChI=1S/C13H9Cl2NO2/c1-18-13(17)9-4-2-8(3-5-9)10-6-7-16-12(15)11(10)14/h2-7H,1H3
InChI key:InChIKey=ZLDDFNXHJWLKEI-UHFFFAOYSA-N
SMILES:ClC=1C(=CC=NC1Cl)C2=CC=C(C(OC)=O)C=C2
Synonyms:
  • Methyl 4-(2,3-dichloro-4-pyridinyl)benzoate
  • Benzoic acid, 4-(2,3-dichloro-4-pyridinyl)-, methyl ester
Found 1 products.