CymitQuimica logo

CAS 1160555-05-4

:

5-[4-(3,5-DiMethyl-4-nitrostyryl)benzaMido]-2-(6-hydroxy-3-oxo-3H-xanthene-9-yl)benzoic Acid Monohydrate

Description:
5-[4-(3,5-DiMethyl-4-nitrostyryl)benzamido]-2-(6-hydroxy-3-oxo-3H-xanthene-9-yl)benzoic Acid Monohydrate is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, hydroxyls, and nitro groups. This compound features a xanthene core, which is known for its fluorescent properties, making it potentially useful in applications such as dyes or fluorescent markers. The presence of the nitrostyryl moiety suggests that it may exhibit interesting electronic properties, possibly influencing its reactivity and interaction with light. As a monohydrate, it contains one molecule of water per formula unit, which can affect its solubility and stability. The compound's unique combination of aromatic rings and functional groups may also impart specific biological activities, making it a candidate for further research in medicinal chemistry or materials science. Overall, its structural complexity and potential applications highlight its significance in various fields of chemical research.
Formula:C37H26N2O8
InChI:InChI=1S/C37H26N2O8/c1-20-15-23(16-21(2)35(20)39(45)46)4-3-22-5-7-24(8-6-22)36(42)38-25-9-12-28(31(17-25)37(43)44)34-29-13-10-26(40)18-32(29)47-33-19-27(41)11-14-30(33)34/h3-19,40H,1-2H3,(H,38,42)(H,43,44)/b4-3+
InChI key:UQQWUXKLZVVNDR-ONEGZZNKSA-N
SMILES:CC1=CC(=CC(=C1[N+](=O)[O-])C)/C=C/C2=CC=C(C=C2)C(=O)NC3=CC(=C(C=C3)C4=C5C=CC(=O)C=C5OC6=C4C=CC(=C6)O)C(=O)O
Found 1 products.