CymitQuimica logo

CAS 1160573-19-2

:

4-Chloro-3,5-difluorobenzoic acid

Description:
4-Chloro-3,5-difluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with chlorine and fluorine atoms. Specifically, it features a chlorine atom at the para position (4-position) and two fluorine atoms at the meta positions (3 and 5) of the benzene ring. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. The presence of electronegative halogens influences its chemical reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its acidic properties are attributed to the carboxylic acid functional group, which can donate protons in solution. 4-Chloro-3,5-difluorobenzoic acid may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds, and its unique substitution pattern can impart specific biological activities or enhance the properties of the resulting products.
Formula:C7H3ClF2O2
InChI:InChI=1S/C7H3ClF2O2/c8-6-4(9)1-3(7(11)12)2-5(6)10/h1-2H,(H,11,12)
InChI key:PVIHLHXXVCVGTP-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)Cl)F)C(=O)O
Found 6 products.