CymitQuimica logo

CAS 1160573-50-1

:

1,4-Dibromo-2-methyl-3-nitrobenzene

Description:
1,4-Dibromo-2-methyl-3-nitrobenzene is an aromatic compound characterized by the presence of two bromine atoms, a methyl group, and a nitro group attached to a benzene ring. The bromine substituents are located at the 1 and 4 positions, while the methyl and nitro groups are positioned at the 2 and 3 positions, respectively. This compound exhibits typical properties of halogenated aromatic compounds, including increased reactivity due to the presence of the electron-withdrawing nitro group, which can influence electrophilic substitution reactions. The bromine atoms contribute to the compound's potential for further chemical transformations, such as nucleophilic substitution. Additionally, the nitro group enhances the compound's polarity, affecting its solubility in various solvents. 1,4-Dibromo-2-methyl-3-nitrobenzene may also exhibit biological activity, making it of interest in fields such as medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as halogenated aromatics can pose environmental and health risks.
Formula:C7H5Br2NO2
InChI:InChI=1S/C7H5Br2NO2/c1-4-5(8)2-3-6(9)7(4)10(11)12/h2-3H,1H3
InChI key:InChIKey=MBTRDSFQFAQCPY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(Br)=CC=C1Br
Synonyms:
  • 1,4-Dibromo-2-methyl-3-nitrobenzene
  • Benzene, 1,4-dibromo-2-methyl-3-nitro-
Found 1 products.