CymitQuimica logo

CAS 1160574-56-0

:

Benzene, 1-bromo-2-chloro-5-fluoro-4-iodo-

Description:
Benzene, 1-bromo-2-chloro-5-fluoro-4-iodo- is a halogenated aromatic compound characterized by the presence of multiple halogen substituents on a benzene ring. This compound features bromine, chlorine, fluorine, and iodine atoms attached to the aromatic system, which significantly influences its chemical reactivity and physical properties. The presence of these halogens can enhance the compound's electrophilic character, making it more reactive in nucleophilic substitution reactions. Additionally, the varying electronegativities of the halogens contribute to the compound's dipole moment, affecting its solubility in different solvents. The compound may exhibit unique biological activity due to its complex structure, making it of interest in fields such as medicinal chemistry and materials science. Its synthesis typically involves halogenation reactions, and it may be used as an intermediate in the production of more complex organic molecules. Safety precautions are essential when handling this compound, as halogenated aromatics can pose health risks and environmental concerns.
Formula:C6H2BrClFI
InChI:InChI=1S/C6H2BrClFI/c7-3-1-5(9)6(10)2-4(3)8/h1-2H
InChI key:InChIKey=GDIBVSLSICCPMY-UHFFFAOYSA-N
SMILES:BrC1=C(Cl)C=C(I)C(F)=C1
Synonyms:
  • Benzene, 1-bromo-2-chloro-5-fluoro-4-iodo-
  • 1-Bromo-2-chloro-5-fluoro-4-iodobenzene
Found 3 products.