CymitQuimica logo

CAS 1160574-79-7

:

1,3-Dibromo-4-chloro-2-fluoro-5-methylbenzene

Description:
1,3-Dibromo-4-chloro-2-fluoro-5-methylbenzene is an aromatic compound characterized by the presence of multiple halogen substituents and a methyl group on a benzene ring. The structure features two bromine atoms, one chlorine atom, and one fluorine atom, which contribute to its reactivity and physical properties. The presence of these halogens typically enhances the compound's polarity and can influence its solubility in various solvents. The methyl group provides additional steric hindrance and can affect the compound's overall stability and reactivity. This compound may exhibit interesting chemical behavior, such as participating in electrophilic aromatic substitution reactions or serving as a precursor in organic synthesis. Its unique combination of halogen atoms may also impart specific biological activity, making it of interest in fields such as medicinal chemistry or agrochemicals. Safety and handling precautions are essential due to the potential toxicity associated with halogenated compounds. Overall, 1,3-Dibromo-4-chloro-2-fluoro-5-methylbenzene is a complex molecule with diverse applications in chemical research and industry.
Formula:C7H4Br2ClF
InChI:InChI=1S/C7H4Br2ClF/c1-3-2-4(8)7(11)5(9)6(3)10/h2H,1H3
InChI key:InChIKey=APYZTQUAIBBWBX-UHFFFAOYSA-N
SMILES:ClC1=C(Br)C(F)=C(Br)C=C1C
Synonyms:
  • 1,3-Dibromo-4-chloro-2-fluoro-5-methylbenzene
  • Benzene, 1,3-dibromo-4-chloro-2-fluoro-5-methyl-
Found 2 products.