CymitQuimica logo

CAS 116064-77-8

:

dehydromiltirone

Description:
Dehydromiltirone is a naturally occurring compound classified as a sesquiterpenoid, primarily derived from the plant Miltiradia phaeocarpa, which is known for its traditional medicinal uses. This compound is characterized by its unique chemical structure, which includes a bicyclic framework and multiple functional groups that contribute to its biological activity. Dehydromiltirone has garnered interest in pharmacological research due to its potential anti-inflammatory, antioxidant, and antimicrobial properties. Its mechanism of action is thought to involve the modulation of various biochemical pathways, making it a candidate for further investigation in drug development. Additionally, dehydromiltirone's solubility and stability in different solvents can vary, influencing its bioavailability and efficacy in therapeutic applications. As with many natural products, the extraction and purification processes are crucial for obtaining this compound in a form suitable for research and potential clinical use. Overall, dehydromiltirone represents a promising area of study within the field of natural product chemistry and pharmacology.
Formula:C19H20O2
InChI:InChI=1/C19H20O2/c1-11(2)14-10-12-7-8-15-13(6-5-9-19(15,3)4)16(12)18(21)17(14)20/h5-8,10-11H,9H2,1-4H3
SMILES:CC(C)C1=Cc2ccc3c(C=CCC3(C)C)c2C(=O)C1=O
Synonyms:
  • 7,8-Dihydro-8,8-dimethyl-2-(1-methylethyl)-3,4-phenanthrenedione
  • 3,4-Phenanthrenedione, 7,8-dihydro-8,8-dimethyl-2-(1-methylethyl)-
  • 8,8-Dimethyl-2-(1-Methylethyl)-7,8-Dihydrophenanthrene-3,4-Dione
Found 4 products.