CymitQuimica logo

CAS 116070-39-4

:

3-Methyl-5-(trifluoromethyl)benzaldehyde

Description:
3-Methyl-5-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a methyl group and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical reactions, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care due to potential irritant properties and environmental considerations. Overall, 3-Methyl-5-(trifluoromethyl)benzaldehyde is a valuable compound in synthetic organic chemistry, particularly in the development of fluorinated organic materials.
Formula:C9H7F3O
InChI:InChI=1S/C9H7F3O/c1-6-2-7(5-13)4-8(3-6)9(10,11)12/h2-5H,1H3
InChI key:InChIKey=KFRRYUVXFZQWGS-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C=O)=CC(C)=C1
Synonyms:
  • 3-Methyl-5-trifluoromethylbenzaldehyde
  • Benzaldehyde, 3-methyl-5-(trifluoromethyl)-
  • 3-Methyl-5-(trifluoromethyl)benzaldehyde
Found 3 products.