CymitQuimica logo

CAS 1160861-59-5

:

Di-Ad-BrettPhos

Description:
Di-Ad-BrettPhos, identified by its CAS number 1160861-59-5, is a chemical compound that belongs to the class of phosphine ligands, which are often utilized in coordination chemistry and catalysis. This substance is characterized by its ability to form stable complexes with various metal ions, making it valuable in applications such as catalysis in organic synthesis and in the development of new materials. Di-Ad-BrettPhos typically exhibits good thermal stability and solubility in organic solvents, which enhances its utility in various chemical reactions. The presence of multiple aryl groups in its structure contributes to its steric and electronic properties, allowing for selective reactivity in catalytic processes. Additionally, its phosphine functionality can participate in various chemical transformations, including oxidation and coordination with transition metals. Overall, Di-Ad-BrettPhos is an important compound in the field of organometallic chemistry, particularly in the design of efficient catalysts for industrial applications.
Formula:C43H61O2P
InChI:InChI=1S/C43H61O2P/c1-25(2)34-17-35(26(3)4)39(36(18-34)27(5)6)40-37(44-7)9-10-38(45-8)41(40)46(42-19-28-11-29(20-42)13-30(12-28)21-42)43-22-31-14-32(23-43)16-33(15-31)24-43/h9-10,17-18,25-33H,11-16,19-24H2,1-8H3
InChI key:NMGHOZQCYNKWBG-UHFFFAOYSA-N
SMILES:CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2P(C34CC5CC(C3)CC(C5)C4)C67CC8CC(C6)CC(C8)C7)OC)OC)C(C)C
Synonyms:
  • Di(adamantan-1-yl)(2',4',6'-triisopropyl-3,6-dimethoxy-2-biphenyl yl)phosphine
  • AdBrettPhos
Found 5 products.