CymitQuimica logo

CAS 116118-98-0

:

4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid

Description:
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine moiety. This compound features a saturated tetrahydro framework, contributing to its stability and reactivity. The presence of a carboxylic acid functional group enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions and applications. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. The compound's molecular structure allows for various substitution patterns, which can influence its pharmacological profile. Additionally, its CAS number, 116118-98-0, serves as a unique identifier for regulatory and safety information. Overall, 4,5,6,7-tetrahydrothieno[3,2-c]pyridine-2-carboxylic acid is of interest in medicinal chemistry and organic synthesis due to its diverse functional properties and potential therapeutic applications.
Formula:C8H9NO2S
InChI:InChI=1/C8H9NO2S/c10-8(11)7-3-5-4-9-2-1-6(5)12-7/h3,9H,1-2,4H2,(H,10,11)
InChI key:OEYJTWUFGQRSOD-UHFFFAOYSA-N
SMILES:C1CNCc2cc(C(=O)O)sc12
Synonyms:
  • Thieno[3,2-c]pyridine-2-carboxylic acid, 4,5,6,7-tetrahydro-
Found 2 products.