CymitQuimica logo

CAS 116119-01-8

:

1,3-Benzodioxole-5-carboxylic acid, 7-hydroxy-, methyl ester

Description:
1,3-Benzodioxole-5-carboxylic acid, 7-hydroxy-, methyl ester, commonly referred to as methyl 7-hydroxy-1,3-benzodioxole-5-carboxylate, is an organic compound characterized by its benzodioxole structure, which consists of a fused dioxole ring and a carboxylic acid moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents. It exhibits properties associated with both aromatic compounds and carboxylic acids, including potential acidity due to the carboxyl group. The presence of the hydroxyl group contributes to its reactivity, allowing for hydrogen bonding and influencing its solubility and interaction with other molecules. Methyl esters are often used in various chemical syntheses and can serve as intermediates in the production of pharmaceuticals and agrochemicals. Additionally, compounds with similar structures may exhibit biological activity, making them of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as they may pose health risks if not managed properly.
Formula:C9H8O5
InChI:InChI=1S/C9H8O5/c1-12-9(11)5-2-6(10)8-7(3-5)13-4-14-8/h2-3,10H,4H2,1H3
InChI key:ZHGPEDRDUUKPCF-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC(=C2C(=C1)OCO2)O
Found 3 products.